C58H98B2O8 — CID 177394805
2-[4-[(E)-2-[2,5-dioctoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-2,5-dioctoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 177394805) has the molecular formula C58H98B2O8 and a molecular weight of 945.04 g/mol. Its IUPAC name is 2-[4-[(E)-2-[2,5-dioctoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-2,5-dioctoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[(E)-2-[2,5-dioctoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-2,5-dioctoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177394805 |
| Molecular Formula | C58H98B2O8 |
| Molecular Weight | 945.04 g/mol |
| Exact Mass | 944.74 |
| IUPAC Name | 2-[4-[(E)-2-[2,5-dioctoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-2,5-dioctoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCOc1cc(B2OC(C)(C)C(C)(C)O2)c(OCCCCCCCC)cc1/C=C/c1cc(OCCCCCCCC)c(B2OC(C)(C)C(C)(C)O2)cc1OCCCCCCCC |
| InChI | InChI=1S/C58H98B2O8/c1-13-17-21-25-29-33-39-61-51-45-49(59-65-55(5,6)56(7,8)66-59)53(63-41-35-31-27-23-19-15-3)43-47(51)37-38-48-44-54(64-42-36-32-28-24-20-16-4)50(60-67-57(9,10)58(11,12)68-60)46-52(48)62-40-34-30-26-22-18-14-2/h37-38,43-46H,13-36,39-42H2,1-12H3/b38-37+ |
| InChIKey | JCUWEJUETVOSSP-HEFFKOSUSA-N |
| XLogP | 15.41 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.04 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|