C38H62B2O6 — CID 102216227
2-[1,5-dioctoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102216227) has the molecular formula C38H62B2O6 and a molecular weight of 636.53 g/mol. Its IUPAC name is 2-[1,5-dioctoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1,5-dioctoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102216227 |
| Molecular Formula | C38H62B2O6 |
| Molecular Weight | 636.53 g/mol |
| Exact Mass | 636.47 |
| IUPAC Name | 2-[1,5-dioctoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCOc1c(B2OC(C)(C)C(C)(C)O2)ccc2c(OCCCCCCCC)c(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C38H62B2O6/c1-11-13-15-17-19-21-27-41-33-29-23-26-32(40-45-37(7,8)38(9,10)46-40)34(42-28-22-20-18-16-14-12-2)30(29)24-25-31(33)39-43-35(3,4)36(5,6)44-39/h23-26H,11-22,27-28H2,1-10H3 |
| InChIKey | MUJNHLOKSBPJMM-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.53 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|