C20H32BFO3 — CID 158403225
2-(2-fluoro-4-octoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 158403225) has the molecular formula C20H32BFO3 and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-(2-fluoro-4-octoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2-fluoro-4-octoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158403225 |
| Molecular Formula | C20H32BFO3 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-(2-fluoro-4-octoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCOc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C20H32BFO3/c1-6-7-8-9-10-11-14-23-16-12-13-17(18(22)15-16)21-24-19(2,3)20(4,5)25-21/h12-13,15H,6-11,14H2,1-5H3 |
| InChIKey | GYIZANGABLYTBX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|