C15H21BF4O3 — CID 142362387
ethane;2-[2-fluoro-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 142362387) has the molecular formula C15H21BF4O3 and a molecular weight of 336.13 g/mol. Its IUPAC name is ethane;2-[2-fluoro-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | ethane;2-[2-fluoro-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142362387 |
| Molecular Formula | C15H21BF4O3 |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethane;2-[2-fluoro-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC.CC1(C)OB(c2ccc(OC(F)(F)F)cc2F)OC1(C)C |
| InChI | InChI=1S/C13H15BF4O3.C2H6/c1-11(2)12(3,4)21-14(20-11)9-6-5-8(7-10(9)15)19-13(16,17)18;1-2/h5-7H,1-4H3;1-2H3 |
| InChIKey | TWMGHYDKPZVTDS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|