C19H24BFO3 — CID 87085409
2-[2-fluoro-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 87085409) has the molecular formula C19H24BFO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-fluoro-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 87085409 |
| Molecular Formula | C19H24BFO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[2-fluoro-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C/C=C\C(=C/C)Oc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C19H24BFO3/c1-7-9-10-14(8-2)22-15-11-12-16(17(21)13-15)20-23-18(3,4)19(5,6)24-20/h7-13H,1H2,2-6H3/b10-9-,14-8+ |
| InChIKey | YFVLILPDAJSTKN-SIWKXLNPSA-N |
| XLogP | 4.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|