C17H26BF3O4 — CID 142412838
ethane;2-[2-(methoxymethyl)-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 142412838) has the molecular formula C17H26BF3O4 and a molecular weight of 362.20 g/mol. Its IUPAC name is ethane;2-[2-(methoxymethyl)-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | ethane;2-[2-(methoxymethyl)-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142412838 |
| Molecular Formula | C17H26BF3O4 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | ethane;2-[2-(methoxymethyl)-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC.COCc1cc(OC(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H20BF3O4.C2H6/c1-13(2)14(3,4)23-16(22-13)12-7-6-11(21-15(17,18)19)8-10(12)9-20-5;1-2/h6-8H,9H2,1-5H3;1-2H3 |
| InChIKey | WAXHDDXMLQURDK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|