C17H29BNO3+ — CID 102102929
[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-trimethylazanium (PubChem CID 102102929) has the molecular formula C17H29BNO3+ and a molecular weight of 306.24 g/mol. Its IUPAC name is [5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-trimethylazanium.
| Compound Name | [5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 102102929 |
| Molecular Formula | C17H29BNO3+ |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-trimethylazanium |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)c(C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C17H29BNO3/c1-16(2)17(3,4)22-18(21-16)15-10-9-14(20-8)11-13(15)12-19(5,6)7/h9-11H,12H2,1-8H3/q+1 |
| InChIKey | OAKSNNOSUUPQKU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|