C26H48B2N2O4+2 — CID 71607674
[2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium (PubChem CID 71607674) has the molecular formula C26H48B2N2O4+2 and a molecular weight of 474.30 g/mol. Its IUPAC name is [2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium.
| Compound Name | [2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 71607674 |
| Molecular Formula | C26H48B2N2O4+2 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 474.38 |
| IUPAC Name | [2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium |
| SMILES | CC1(C)OB(c2cc(C[N+](C)(C)C)c(B3OC(C)(C)C(C)(C)O3)cc2C[N+](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C26H48B2N2O4/c1-23(2)24(3,4)32-27(31-23)21-15-20(18-30(12,13)14)22(16-19(21)17-29(9,10)11)28-33-25(5,6)26(7,8)34-28/h15-16H,17-18H2,1-14H3/q+2 |
| InChIKey | BEORSBQMORLLCG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|