C20H29BNO2+ — CID 177480059
trimethyl-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]methyl]azanium (PubChem CID 177480059) has the molecular formula C20H29BNO2+ and a molecular weight of 326.27 g/mol. Its IUPAC name is trimethyl-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]methyl]azanium.
| Compound Name | trimethyl-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 177480059 |
| Molecular Formula | C20H29BNO2+ |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | trimethyl-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]methyl]azanium |
| SMILES | CC1(C)OB(c2cc(C[N+](C)(C)C)c3ccccc3c2)OC1(C)C |
| InChI | InChI=1S/C20H29BNO2/c1-19(2)20(3,4)24-21(23-19)17-12-15-10-8-9-11-18(15)16(13-17)14-22(5,6)7/h8-13H,14H2,1-7H3/q+1 |
| InChIKey | LRDMPVNYTUMIRI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|