C22H29BO2 — CID 177264639
4,4,5,5-tetramethyl-2-(1,1,2,2-tetramethylacenaphthylen-4-yl)-1,3,2-dioxaborolane (PubChem CID 177264639) has the molecular formula C22H29BO2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1,1,2,2-tetramethylacenaphthylen-4-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1,1,2,2-tetramethylacenaphthylen-4-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177264639 |
| Molecular Formula | C22H29BO2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1,1,2,2-tetramethylacenaphthylen-4-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc3c4c(cccc4c2)C(C)(C)C3(C)C)OC1(C)C |
| InChI | InChI=1S/C22H29BO2/c1-19(2)16-11-9-10-14-12-15(13-17(18(14)16)20(19,3)4)23-24-21(5,6)22(7,8)25-23/h9-13H,1-8H3 |
| InChIKey | WMPSKBXVGKCJDF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|