C33H38BNO2 — CID 90285418
8,8,14,14,22,22-hexamethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 90285418) has the molecular formula C33H38BNO2 and a molecular weight of 491.48 g/mol. Its IUPAC name is 8,8,14,14,22,22-hexamethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,8,14,14,22,22-hexamethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 90285418 |
| Molecular Formula | C33H38BNO2 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 8,8,14,14,22,22-hexamethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC1(C)c2cccc3c2N2c4c1cccc4C(C)(C)c1cc(B4OC(C)(C)C(C)(C)O4)cc(c12)C3(C)C |
| InChI | InChI=1S/C33H38BNO2/c1-29(2)20-13-11-15-22-26(20)35-27-21(29)14-12-16-23(27)31(5,6)25-18-19(17-24(28(25)35)30(22,3)4)34-36-32(7,8)33(9,10)37-34/h11-18H,1-10H3 |
| InChIKey | HHTRZNNPEFQQKL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|