C30H32BNO2 — CID 151913796
8,8,14,14-tetramethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 151913796) has the molecular formula C30H32BNO2 and a molecular weight of 449.40 g/mol. Its IUPAC name is 8,8,14,14-tetramethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 8,8,14,14-tetramethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 151913796 |
| Molecular Formula | C30H32BNO2 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 8,8,14,14-tetramethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | CC1(C)c2ccc(B3OC(C)(C)C(C)(C)O3)c3c2-n2c4c1cccc4c1cccc(c12)C3(C)C |
| InChI | InChI=1S/C30H32BNO2/c1-27(2)19-13-9-11-17-18-12-10-14-20-25(18)32(24(17)19)26-21(27)15-16-22(23(26)28(20,3)4)31-33-29(5,6)30(7,8)34-31/h9-16H,1-8H3 |
| InChIKey | SVINCXXZRYIQIA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|