C27H28BNO3 — CID 67951191
14,14-dimethyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 67951191) has the molecular formula C27H28BNO3 and a molecular weight of 425.34 g/mol. Its IUPAC name is 14,14-dimethyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 14,14-dimethyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 67951191 |
| Molecular Formula | C27H28BNO3 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 14,14-dimethyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC1(C)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2N2c3ccccc3Oc3cccc1c32 |
| InChI | InChI=1S/C27H28BNO3/c1-25(2)18-10-9-13-23-24(18)29(21-11-7-8-12-22(21)30-23)20-15-14-17(16-19(20)25)28-31-26(3,4)27(5,6)32-28/h7-16H,1-6H3 |
| InChIKey | NVPDOHUYSYZRPA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|