C27H30BNO2 — CID 71007069
9,9-dimethyl-10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridine (PubChem CID 71007069) has the molecular formula C27H30BNO2 and a molecular weight of 411.35 g/mol. Its IUPAC name is 9,9-dimethyl-10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridine.
| Compound Name | 9,9-dimethyl-10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridine |
|---|---|
| PubChem CID | 71007069 |
| Molecular Formula | C27H30BNO2 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 9,9-dimethyl-10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridine |
| SMILES | CC1(C)c2ccccc2N(c2ccccc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C27H30BNO2/c1-25(2)21-14-10-11-15-23(21)29(20-12-8-7-9-13-20)24-17-16-19(18-22(24)25)28-30-26(3,4)27(5,6)31-28/h7-18H,1-6H3 |
| InChIKey | LOWOTKYHBZGQPR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|