C30H28BNO2S — CID 149398395
10-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenothiazine (PubChem CID 149398395) has the molecular formula C30H28BNO2S and a molecular weight of 477.44 g/mol. Its IUPAC name is 10-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenothiazine.
| Compound Name | 10-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenothiazine |
|---|---|
| PubChem CID | 149398395 |
| Molecular Formula | C30H28BNO2S |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 10-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenothiazine |
| SMILES | CC1(C)OB(c2cccc(-c3ccc4c(c3)Sc3ccccc3N4c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C30H28BNO2S/c1-29(2)30(3,4)34-31(33-29)23-12-10-11-21(19-23)22-17-18-26-28(20-22)35-27-16-9-8-15-25(27)32(26)24-13-6-5-7-14-24/h5-20H,1-4H3 |
| InChIKey | YOWZRKIGMLNVJO-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|