C28H25BO2S — CID 153344890
4,4,5,5-tetramethyl-2-[3-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 153344890) has the molecular formula C28H25BO2S and a molecular weight of 436.39 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 153344890 |
| Molecular Formula | C28H25BO2S |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc(-c3ccc4c(c3)Sc3cccc5cccc-4c35)c2)OC1(C)C |
| InChI | InChI=1S/C28H25BO2S/c1-27(2)28(3,4)31-29(30-27)21-11-5-10-19(16-21)20-14-15-22-23-12-6-8-18-9-7-13-24(26(18)23)32-25(22)17-20/h5-17H,1-4H3 |
| InChIKey | DJQLZRJEDQBYLD-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|