C37H32BNO2S — CID 153348350
7-[3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]benzo[b][1,4]benzothiazepine (PubChem CID 153348350) has the molecular formula C37H32BNO2S and a molecular weight of 565.55 g/mol. Its IUPAC name is 7-[3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]benzo[b][1,4]benzothiazepine.
| Compound Name | 7-[3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 153348350 |
| Molecular Formula | C37H32BNO2S |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 7-[3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]benzo[b][1,4]benzothiazepine |
| SMILES | CC1(C)OB(c2cccc(-c3cccc(-c4cccc(-c5cccc6c5C=Nc5ccccc5S6)c4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C37H32BNO2S/c1-36(2)37(3,4)41-38(40-36)30-16-9-14-28(23-30)26-12-7-11-25(21-26)27-13-8-15-29(22-27)31-17-10-20-34-32(31)24-39-33-18-5-6-19-35(33)42-34/h5-24H,1-4H3 |
| InChIKey | ULKYWYISFBWYAJ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|