C51H47BN2O2 — CID 123572425
9,9-dimethyl-10-phenyl-N,N-bis(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-2-amine (PubChem CID 123572425) has the molecular formula C51H47BN2O2 and a molecular weight of 730.76 g/mol. Its IUPAC name is 9,9-dimethyl-10-phenyl-N,N-bis(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-2-amine.
| Compound Name | 9,9-dimethyl-10-phenyl-N,N-bis(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-2-amine |
|---|---|
| PubChem CID | 123572425 |
| Molecular Formula | C51H47BN2O2 |
| Molecular Weight | 730.76 g/mol |
| Exact Mass | 730.37 |
| IUPAC Name | 9,9-dimethyl-10-phenyl-N,N-bis(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-2-amine |
| SMILES | CC1(C)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2N(c2ccccc2)c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C51H47BN2O2/c1-49(2)45-34-40(52-55-50(3,4)51(5,6)56-52)26-32-47(45)54(41-20-14-9-15-21-41)48-33-31-44(35-46(48)49)53(42-27-22-38(23-28-42)36-16-10-7-11-17-36)43-29-24-39(25-30-43)37-18-12-8-13-19-37/h7-35H,1-6H3 |
| InChIKey | ANLMMQYMGXDTTD-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.76 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|