C42H42BNO2 — CID 90330281
8,8,14,14-tetramethyl-5,17-diphenyl-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 90330281) has the molecular formula C42H42BNO2 and a molecular weight of 603.62 g/mol. Its IUPAC name is 8,8,14,14-tetramethyl-5,17-diphenyl-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,8,14,14-tetramethyl-5,17-diphenyl-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 90330281 |
| Molecular Formula | C42H42BNO2 |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | 8,8,14,14-tetramethyl-5,17-diphenyl-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC1(C)c2cc(-c3ccccc3)ccc2N2c3ccc(-c4ccccc4)cc3C(C)(C)c3cc(B4OC(C)(C)C(C)(C)O4)cc1c32 |
| InChI | InChI=1S/C42H42BNO2/c1-39(2)32-23-29(27-15-11-9-12-16-27)19-21-36(32)44-37-22-20-30(28-17-13-10-14-18-28)24-33(37)40(3,4)35-26-31(25-34(39)38(35)44)43-45-41(5,6)42(7,8)46-43/h9-26H,1-8H3 |
| InChIKey | JWRGCFWFKYGSBV-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|