C24H24BNO2Se — CID 172808799
10-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenoselenazine (PubChem CID 172808799) has the molecular formula C24H24BNO2Se and a molecular weight of 448.23 g/mol. Its IUPAC name is 10-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenoselenazine.
| Compound Name | 10-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenoselenazine |
|---|---|
| PubChem CID | 172808799 |
| Molecular Formula | C24H24BNO2Se |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 10-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenoselenazine |
| SMILES | CC1(C)OB(c2ccc(N3c4ccccc4[Se]c4ccccc43)cc2)OC1(C)C |
| InChI | InChI=1S/C24H24BNO2Se/c1-23(2)24(3,4)28-25(27-23)17-13-15-18(16-14-17)26-19-9-5-7-11-21(19)29-22-12-8-6-10-20(22)26/h5-16H,1-4H3 |
| InChIKey | RWOFGUOACCLOOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|