C31H37B2NO6 — CID 59302117
10-(4-methoxyphenyl)-3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxazine (PubChem CID 59302117) has the molecular formula C31H37B2NO6 and a molecular weight of 541.26 g/mol. Its IUPAC name is 10-(4-methoxyphenyl)-3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxazine.
| Compound Name | 10-(4-methoxyphenyl)-3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxazine |
|---|---|
| PubChem CID | 59302117 |
| Molecular Formula | C31H37B2NO6 |
| Molecular Weight | 541.26 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 10-(4-methoxyphenyl)-3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxazine |
| SMILES | COc1ccc(N2c3ccc(B4OC(C)(C)C(C)(C)O4)cc3Oc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)cc1 |
| InChI | InChI=1S/C31H37B2NO6/c1-28(2)29(3,4)38-32(37-28)20-10-16-24-26(18-20)36-27-19-21(33-39-30(5,6)31(7,8)40-33)11-17-25(27)34(24)22-12-14-23(35-9)15-13-22/h10-19H,1-9H3 |
| InChIKey | SNUPCHHVXVCZEG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.26 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|