C43H38N2O6 — CID 102495613
2,2',7,7'-tetramethoxy-10,10'-bis(4-methoxyphenyl)-9,9'-spirobi[acridine] (PubChem CID 102495613) has the molecular formula C43H38N2O6 and a molecular weight of 678.78 g/mol. Its IUPAC name is 2,2',7,7'-tetramethoxy-10,10'-bis(4-methoxyphenyl)-9,9'-spirobi[acridine].
| Compound Name | 2,2',7,7'-tetramethoxy-10,10'-bis(4-methoxyphenyl)-9,9'-spirobi[acridine] |
|---|---|
| PubChem CID | 102495613 |
| Molecular Formula | C43H38N2O6 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | 2,2',7,7'-tetramethoxy-10,10'-bis(4-methoxyphenyl)-9,9'-spirobi[acridine] |
| SMILES | COc1ccc(N2c3ccc(OC)cc3C3(c4cc(OC)ccc42)c2cc(OC)ccc2N(c2ccc(OC)cc2)c2ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C43H38N2O6/c1-46-29-11-7-27(8-12-29)44-39-19-15-31(48-3)23-35(39)43(36-24-32(49-4)16-20-40(36)44)37-25-33(50-5)17-21-41(37)45(28-9-13-30(47-2)14-10-28)42-22-18-34(51-6)26-38(42)43/h7-26H,1-6H3 |
| InChIKey | VIFQSVCPQCYAJL-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |