C11H12BrNO2 — CID 163653219
3-bromo-5-methoxy-1,3-dimethylindol-2-one (PubChem CID 163653219) has the molecular formula C11H12BrNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is 3-bromo-5-methoxy-1,3-dimethylindol-2-one.
| Compound Name | 3-bromo-5-methoxy-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 163653219 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 3-bromo-5-methoxy-1,3-dimethylindol-2-one |
| SMILES | COc1ccc2c(c1)C(C)(Br)C(=O)N2C |
| InChI | InChI=1S/C11H12BrNO2/c1-11(12)8-6-7(15-3)4-5-9(8)13(2)10(11)14/h4-6H,1-3H3 |
| InChIKey | INZODNRYIAYGIR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|