C17H14N2O3 — CID 132531797
(2R)-5'-methoxy-1'-methylspiro[1H-indole-2,3'-indole]-2',3-dione (PubChem CID 132531797) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2R)-5'-methoxy-1'-methylspiro[1H-indole-2,3'-indole]-2',3-dione.
| Compound Name | (2R)-5'-methoxy-1'-methylspiro[1H-indole-2,3'-indole]-2',3-dione |
|---|---|
| PubChem CID | 132531797 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R)-5'-methoxy-1'-methylspiro[1H-indole-2,3'-indole]-2',3-dione |
| SMILES | COc1ccc2c(c1)[C@]1(Nc3ccccc3C1=O)C(=O)N2C |
| InChI | InChI=1S/C17H14N2O3/c1-19-14-8-7-10(22-2)9-12(14)17(16(19)21)15(20)11-5-3-4-6-13(11)18-17/h3-9,18H,1-2H3/t17-/m1/s1 |
| InChIKey | VCHZWNSUQUTXEC-QGZVFWFLSA-N |
| XLogP | 2.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|