C20H15NO4 — CID 170551612
6'-methoxy-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione (PubChem CID 170551612) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 6'-methoxy-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione.
| Compound Name | 6'-methoxy-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione |
|---|---|
| PubChem CID | 170551612 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 6'-methoxy-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione |
| SMILES | COc1ccc2c(c1)C1(C=CC2=O)C(=O)N(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H15NO4/c1-21-18(23)14-5-3-4-6-15(14)20(19(21)24)10-9-17(22)13-8-7-12(25-2)11-16(13)20/h3-11H,1-2H3 |
| InChIKey | SUVSINZBTCQDCY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|