C14H14N2O3Se — CID 172557865
(6-methoxy-2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)methyl selenocyanate (PubChem CID 172557865) has the molecular formula C14H14N2O3Se and a molecular weight of 337.24 g/mol. Its IUPAC name is (6-methoxy-2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)methyl selenocyanate.
| Compound Name | (6-methoxy-2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)methyl selenocyanate |
|---|---|
| PubChem CID | 172557865 |
| Molecular Formula | C14H14N2O3Se |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | (6-methoxy-2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)methyl selenocyanate |
| SMILES | COc1ccc2c(c1)C(C)(C[Se]C#N)C(=O)N(C)C2=O |
| InChI | InChI=1S/C14H14N2O3Se/c1-14(7-20-8-15)11-6-9(19-3)4-5-10(11)12(17)16(2)13(14)18/h4-6H,7H2,1-3H3 |
| InChIKey | HKXMYCOOACKIAM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|