About 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile
1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile (PubChem CID 149279161) has the molecular formula C21H17NO3
and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile.
Molecular Properties
| Compound Name | 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
| PubChem CID | 149279161 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
| SMILES | COc1ccc2c(c1)C(C)(C)C1=C(C2=O)c2ccc(C#N)c(O)c2C1 |
| InChI | InChI=1S/C21H17NO3/c1-21(2)16-8-12(25-3)5-7-14(16)20(24)18-13-6-4-11(10-22)19(23)15(13)9-17(18)21/h4-8,23H,9H2,1-3H3 |
| InChIKey | XSPQFNZAYWBHQF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
The IUPAC name of 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile (CID 149279161) is 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile.
What is the SMILES notation for 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
The canonical SMILES for 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile is COc1ccc2c(c1)C(C)(C)C1=C(C2=O)c2ccc(C#N)c(O)c2C1.
What is the InChIKey of 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
The InChIKey is XSPQFNZAYWBHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO3/c1-21(2)16-8-12(25-3)5-7-14(16)20(24)18-13-6-4-11(10-22)19(23)15(13)9-17(18)21/h4-8,23H,9H2,1-3H3.
What are the key properties of 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile has a molecular weight of 331.37 g/mol, XLogP of 3.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile is sourced from PubChem (CID 149279161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).