About 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid
5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid (PubChem CID 146832312) has the molecular formula C25H23NO4
and a molecular weight of 401.46 g/mol. Its IUPAC name is 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid.
Molecular Properties
| Compound Name | 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid |
| PubChem CID | 146832312 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid |
| SMILES | CC1(C)C2=C(C(=O)c3cc(OCCCCC(=O)O)ccc31)c1ccc(C#N)cc1C2 |
| InChI | InChI=1S/C25H23NO4/c1-25(2)20-9-7-17(30-10-4-3-5-22(27)28)13-19(20)24(29)23-18-8-6-15(14-26)11-16(18)12-21(23)25/h6-9,11,13H,3-5,10,12H2,1-2H3,(H,27,28) |
| InChIKey | SELCUEIGUUPPGX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid?
The IUPAC name of 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid (CID 146832312) is 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid.
What is the SMILES notation for 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid?
The canonical SMILES for 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid is CC1(C)C2=C(C(=O)c3cc(OCCCCC(=O)O)ccc31)c1ccc(C#N)cc1C2.
What is the InChIKey of 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid?
The InChIKey is SELCUEIGUUPPGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO4/c1-25(2)20-9-7-17(30-10-4-3-5-22(27)28)13-19(20)24(29)23-18-8-6-15(14-26)11-16(18)12-21(23)25/h6-9,11,13H,3-5,10,12H2,1-2H3,(H,27,28).
What are the key properties of 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid?
5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid has a molecular weight of 401.46 g/mol, XLogP of 4.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid is sourced from PubChem (CID 146832312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).