C25H23NO4 — CID 146832312
5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid (PubChem CID 146832312) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid.
| Compound Name | 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid |
|---|---|
| PubChem CID | 146832312 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 5-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]pentanoic acid |
| SMILES | CC1(C)C2=C(C(=O)c3cc(OCCCCC(=O)O)ccc31)c1ccc(C#N)cc1C2 |
| InChI | InChI=1S/C25H23NO4/c1-25(2)20-9-7-17(30-10-4-3-5-22(27)28)13-19(20)24(29)23-18-8-6-15(14-26)11-16(18)12-21(23)25/h6-9,11,13H,3-5,10,12H2,1-2H3,(H,27,28) |
| InChIKey | SELCUEIGUUPPGX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|