C26H28N2O2 — CID 153235398
8-[2-(tert-butylamino)ethoxy]-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile (PubChem CID 153235398) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 8-[2-(tert-butylamino)ethoxy]-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile.
| Compound Name | 8-[2-(tert-butylamino)ethoxy]-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 153235398 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 8-[2-(tert-butylamino)ethoxy]-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
| SMILES | CC(C)(C)NCCOc1ccc2c(c1)C(C)(C)C1=C(C2=O)c2ccc(C#N)cc2C1 |
| InChI | InChI=1S/C26H28N2O2/c1-25(2,3)28-10-11-30-18-7-9-20-21(14-18)26(4,5)22-13-17-12-16(15-27)6-8-19(17)23(22)24(20)29/h6-9,12,14,28H,10-11,13H2,1-5H3 |
| InChIKey | WQJRKYAASKNSED-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|