C25H28N2O4 — CID 158597357
8-[2-(diethylamino)ethoxy]-10,10-dimethyl-2-nitro-11H-benzo[b]fluoren-5-one (PubChem CID 158597357) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 8-[2-(diethylamino)ethoxy]-10,10-dimethyl-2-nitro-11H-benzo[b]fluoren-5-one.
| Compound Name | 8-[2-(diethylamino)ethoxy]-10,10-dimethyl-2-nitro-11H-benzo[b]fluoren-5-one |
|---|---|
| PubChem CID | 158597357 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 8-[2-(diethylamino)ethoxy]-10,10-dimethyl-2-nitro-11H-benzo[b]fluoren-5-one |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(C)(C)C1=C(C2=O)c2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C25H28N2O4/c1-5-26(6-2)11-12-31-18-8-10-20-21(15-18)25(3,4)22-14-16-13-17(27(29)30)7-9-19(16)23(22)24(20)28/h7-10,13,15H,5-6,11-12,14H2,1-4H3 |
| InChIKey | LQUUWXDWSGOICR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|