C13H21ClN2O3 — CID 19863387
N,N-diethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride (PubChem CID 19863387) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. Its IUPAC name is N,N-diethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride.
| Compound Name | N,N-diethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 19863387 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N,N-diethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride |
| SMILES | CCN(CC)CCCOc1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C13H20N2O3.ClH/c1-3-14(4-2)10-5-11-18-13-8-6-12(7-9-13)15(16)17;/h6-9H,3-5,10-11H2,1-2H3;1H |
| InChIKey | FFNOSTVOHRROCM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|