C19H24N4O3 — CID 112758541
N,N-diethyl-2-[4-[[(4-nitrophenyl)diazenyl]methyl]phenoxy]ethanamine (PubChem CID 112758541) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[[(4-nitrophenyl)diazenyl]methyl]phenoxy]ethanamine.
| Compound Name | N,N-diethyl-2-[4-[[(4-nitrophenyl)diazenyl]methyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 112758541 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N,N-diethyl-2-[4-[[(4-nitrophenyl)diazenyl]methyl]phenoxy]ethanamine |
| SMILES | CCN(CC)CCOc1ccc(C/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-3-22(4-2)13-14-26-19-11-5-16(6-12-19)15-20-21-17-7-9-18(10-8-17)23(24)25/h5-12H,3-4,13-15H2,1-2H3/b21-20+ |
| InChIKey | UWZVUTQXUDZKKL-QZQOTICOSA-N |
| XLogP | 4.60 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|