C24H21NO4 — CID 152956294
4-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]butanoic acid (PubChem CID 152956294) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]butanoic acid.
| Compound Name | 4-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 152956294 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-[(2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-7-yl)oxy]butanoic acid |
| SMILES | CC1(C)C2=C(C(=O)c3cc(OCCCC(=O)O)ccc31)c1ccc(C#N)cc1C2 |
| InChI | InChI=1S/C24H21NO4/c1-24(2)19-8-6-16(29-9-3-4-21(26)27)12-18(19)23(28)22-17-7-5-14(13-25)10-15(17)11-20(22)24/h5-8,10,12H,3-4,9,11H2,1-2H3,(H,26,27) |
| InChIKey | UPRQQDBNTBGHOT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|