C21H13ClF3NO4S — CID 149211222
(7-chloro-2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-8-yl) trifluoromethanesulfonate (PubChem CID 149211222) has the molecular formula C21H13ClF3NO4S and a molecular weight of 467.85 g/mol. Its IUPAC name is (7-chloro-2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-8-yl) trifluoromethanesulfonate.
| Compound Name | (7-chloro-2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 149211222 |
| Molecular Formula | C21H13ClF3NO4S |
| Molecular Weight | 467.85 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | (7-chloro-2-cyano-10,10-dimethyl-5-oxo-11H-benzo[b]fluoren-8-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)C2=C(C(=O)c3cc(Cl)c(OS(=O)(=O)C(F)(F)F)cc31)c1ccc(C#N)cc1C2 |
| InChI | InChI=1S/C21H13ClF3NO4S/c1-20(2)14-8-17(30-31(28,29)21(23,24)25)16(22)7-13(14)19(27)18-12-4-3-10(9-26)5-11(12)6-15(18)20/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | XGPUTPAXUIGXDP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.85 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|