About 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile
7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile (PubChem CID 147714157) has the molecular formula C26H24N2O2
and a molecular weight of 396.49 g/mol. Its IUPAC name is 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile.
Molecular Properties
| Compound Name | 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
| PubChem CID | 147714157 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
| SMILES | C=Cc1cc2c(cc1N1CCOCC1)C(C)(C)C1=C(C2=O)c2ccc(C#N)cc2C1 |
| InChI | InChI=1S/C26H24N2O2/c1-4-17-12-20-21(14-23(17)28-7-9-30-10-8-28)26(2,3)22-13-18-11-16(15-27)5-6-19(18)24(22)25(20)29/h4-6,11-12,14H,1,7-10,13H2,2-3H3 |
| InChIKey | GVHMYSYOYZGMJU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
The IUPAC name of 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile (CID 147714157) is 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile.
What is the SMILES notation for 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
The canonical SMILES for 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile is C=Cc1cc2c(cc1N1CCOCC1)C(C)(C)C1=C(C2=O)c2ccc(C#N)cc2C1.
What is the InChIKey of 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
The InChIKey is GVHMYSYOYZGMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O2/c1-4-17-12-20-21(14-23(17)28-7-9-30-10-8-28)26(2,3)22-13-18-11-16(15-27)5-6-19(18)24(22)25(20)29/h4-6,11-12,14H,1,7-10,13H2,2-3H3.
What are the key properties of 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile?
7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile has a molecular weight of 396.49 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-10,10-dimethyl-8-morpholin-4-yl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile is sourced from PubChem (CID 147714157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).