C31H35N3O3 — CID 147139191
8-(4-cyclobutylpiperazin-1-yl)-7-(2-methoxyethoxy)-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile (PubChem CID 147139191) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is 8-(4-cyclobutylpiperazin-1-yl)-7-(2-methoxyethoxy)-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile.
| Compound Name | 8-(4-cyclobutylpiperazin-1-yl)-7-(2-methoxyethoxy)-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 147139191 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 8-(4-cyclobutylpiperazin-1-yl)-7-(2-methoxyethoxy)-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
| SMILES | COCCOc1cc2c(cc1N1CCN(C3CCC3)CC1)C(C)(C)C1=C(C2=O)c2ccc(C#N)cc2C1 |
| InChI | InChI=1S/C31H35N3O3/c1-31(2)25-18-27(34-11-9-33(10-12-34)22-5-4-6-22)28(37-14-13-36-3)17-24(25)30(35)29-23-8-7-20(19-32)15-21(23)16-26(29)31/h7-8,15,17-18,22H,4-6,9-14,16H2,1-3H3 |
| InChIKey | BRTQYJWAYCIINP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|