C23H17NO2 — CID 159784155
7-ethynyl-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile (PubChem CID 159784155) has the molecular formula C23H17NO2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 7-ethynyl-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile.
| Compound Name | 7-ethynyl-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 159784155 |
| Molecular Formula | C23H17NO2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 7-ethynyl-8-methoxy-10,10-dimethyl-5-oxo-11H-benzo[b]fluorene-2-carbonitrile |
| SMILES | C#Cc1cc2c(cc1OC)C(C)(C)C1=C(C2=O)c2ccc(C#N)cc2C1 |
| InChI | InChI=1S/C23H17NO2/c1-5-14-9-17-18(11-20(14)26-4)23(2,3)19-10-15-8-13(12-24)6-7-16(15)21(19)22(17)25/h1,6-9,11H,10H2,2-4H3 |
| InChIKey | NHSXRNCVIRCRSJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|