C25H26N2O5 — CID 134376134
4-hydroxy-8-[3-(2-hydroxypropan-2-yloxy)propoxy]-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 134376134) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-hydroxy-8-[3-(2-hydroxypropan-2-yloxy)propoxy]-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile.
| Compound Name | 4-hydroxy-8-[3-(2-hydroxypropan-2-yloxy)propoxy]-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 134376134 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-hydroxy-8-[3-(2-hydroxypropan-2-yloxy)propoxy]-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | CC(C)(O)OCCCOc1ccc2c(c1)C(C)(C)c1[nH]c3c(O)c(C#N)ccc3c1C2=O |
| InChI | InChI=1S/C25H26N2O5/c1-24(2)18-12-15(31-10-5-11-32-25(3,4)30)7-9-16(18)22(29)19-17-8-6-14(13-26)21(28)20(17)27-23(19)24/h6-9,12,27-28,30H,5,10-11H2,1-4H3 |
| InChIKey | HDYQZHIPVSWUQZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|