C26H28N4O6S — CID 66834149
tert-butyl N-[2-[(3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethylsulfamoyl]carbamate (PubChem CID 66834149) has the molecular formula C26H28N4O6S and a molecular weight of 524.60 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 66834149 |
| Molecular Formula | C26H28N4O6S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | tert-butyl N-[2-[(3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethylsulfamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCCOc1ccc2c(c1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O |
| InChI | InChI=1S/C26H28N4O6S/c1-25(2,3)36-24(32)30-37(33,34)28-10-11-35-16-7-9-17-19(13-16)26(4,5)23-21(22(17)31)18-8-6-15(14-27)12-20(18)29-23/h6-9,12-13,28-29H,10-11H2,1-5H3,(H,30,32) |
| InChIKey | YBNMKRDBFKKGOM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 150.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|