About tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate
tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate (PubChem CID 70195542) has the molecular formula C25H29N3O4
and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate |
| PubChem CID | 70195542 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2c(c1)C(C)(C)c1[nH]c3cc(N)ccc3c1C2=O |
| InChI | InChI=1S/C25H29N3O4/c1-24(2,3)32-23(30)27-10-11-31-15-7-9-16-18(13-15)25(4,5)22-20(21(16)29)17-8-6-14(26)12-19(17)28-22/h6-9,12-13,28H,10-11,26H2,1-5H3,(H,27,30) |
| InChIKey | BWFXJWIPIMJJSA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate (CID 70195542) is tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate is CC(C)(C)OC(=O)NCCOc1ccc2c(c1)C(C)(C)c1[nH]c3cc(N)ccc3c1C2=O.
What is the InChIKey of tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate?
The InChIKey is BWFXJWIPIMJJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O4/c1-24(2,3)32-23(30)27-10-11-31-15-7-9-16-18(13-15)25(4,5)22-20(21(16)29)17-8-6-14(26)12-19(17)28-22/h6-9,12-13,28H,10-11,26H2,1-5H3,(H,27,30).
What are the key properties of tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate?
tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate has a molecular weight of 435.52 g/mol, XLogP of 4.52, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)oxy]ethyl]carbamate is sourced from PubChem (CID 70195542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).