About [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate
[8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate (PubChem CID 167193025) has the molecular formula C28H26N2O5
and a molecular weight of 470.53 g/mol. Its IUPAC name is [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate |
| PubChem CID | 167193025 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate |
| SMILES | CC1(C)c2cc(OCCCO)ccc2C(=O)c2c1[nH]c1cc(OC(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C28H26N2O5/c1-28(2)22-15-18(34-14-6-13-31)9-11-20(22)25(32)24-21-12-10-19(16-23(21)30-26(24)28)35-27(33)29-17-7-4-3-5-8-17/h3-5,7-12,15-16,30-31H,6,13-14H2,1-2H3,(H,29,33) |
| InChIKey | BGMXRZQXBALCMN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate?
The IUPAC name of [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate (CID 167193025) is [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate.
What is the SMILES notation for [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate?
The canonical SMILES for [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate is CC1(C)c2cc(OCCCO)ccc2C(=O)c2c1[nH]c1cc(OC(=O)Nc3ccccc3)ccc21.
What is the InChIKey of [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate?
The InChIKey is BGMXRZQXBALCMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O5/c1-28(2)22-15-18(34-14-6-13-31)9-11-20(22)25(32)24-21-12-10-19(16-23(21)30-26(24)28)35-27(33)29-17-7-4-3-5-8-17/h3-5,7-12,15-16,30-31H,6,13-14H2,1-2H3,(H,29,33).
What are the key properties of [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate?
[8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate has a molecular weight of 470.53 g/mol, XLogP of 5.41, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(3-hydroxypropoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-3-yl] N-phenylcarbamate is sourced from PubChem (CID 167193025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).