C21H21NO4S — CID 118670145
8-[(2R)-2,3-dihydroxypropoxy]-6,6-dimethyl-3-sulfanyl-5H-benzo[b]carbazol-11-one (PubChem CID 118670145) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 8-[(2R)-2,3-dihydroxypropoxy]-6,6-dimethyl-3-sulfanyl-5H-benzo[b]carbazol-11-one.
| Compound Name | 8-[(2R)-2,3-dihydroxypropoxy]-6,6-dimethyl-3-sulfanyl-5H-benzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 118670145 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 8-[(2R)-2,3-dihydroxypropoxy]-6,6-dimethyl-3-sulfanyl-5H-benzo[b]carbazol-11-one |
| SMILES | CC1(C)c2cc(OC[C@H](O)CO)ccc2C(=O)c2c1[nH]c1cc(S)ccc21 |
| InChI | InChI=1S/C21H21NO4S/c1-21(2)16-7-12(26-10-11(24)9-23)3-5-14(16)19(25)18-15-6-4-13(27)8-17(15)22-20(18)21/h3-8,11,22-24,27H,9-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | QTRRDWQYUPPTQI-LLVKDONJSA-N |
| XLogP | 3.06 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|