C25H28N2O2Si — CID 66834106
8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 66834106) has the molecular formula C25H28N2O2Si and a molecular weight of 416.60 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 66834106 |
| Molecular Formula | C25H28N2O2Si |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | CC1(C)c2cc(O[Si](C)(C)C(C)(C)C)ccc2C(=O)c2c1[nH]c1cc(C#N)ccc21 |
| InChI | InChI=1S/C25H28N2O2Si/c1-24(2,3)30(6,7)29-16-9-11-17-19(13-16)25(4,5)23-21(22(17)28)18-10-8-15(14-26)12-20(18)27-23/h8-13,27H,1-7H3 |
| InChIKey | INSGBIIBCRFLFF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|