About (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione
(2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione (PubChem CID 95881455) has the molecular formula C24H21N3O3
and a molecular weight of 399.45 g/mol. Its IUPAC name is (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione.
Molecular Properties
| Compound Name | (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
| PubChem CID | 95881455 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3N[C@@]23C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C24H21N3O3/c1-26-21-10-6-4-8-19(21)24(23(26)29)25-20-9-5-3-7-18(20)22(28)27(24)15-16-11-13-17(30-2)14-12-16/h3-14,25H,15H2,1-2H3/t24-/m1/s1 |
| InChIKey | DRWMVJORJHUMBD-XMMPIXPASA-N |
| XLogP | 3.59 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione?
The IUPAC name of (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione (CID 95881455) is (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione.
What is the SMILES notation for (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione?
The canonical SMILES for (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione is COc1ccc(CN2C(=O)c3ccccc3N[C@@]23C(=O)N(C)c2ccccc23)cc1.
What is the InChIKey of (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione?
The InChIKey is DRWMVJORJHUMBD-XMMPIXPASA-N. The full InChI is InChI=1S/C24H21N3O3/c1-26-21-10-6-4-8-19(21)24(23(26)29)25-20-9-5-3-7-18(20)22(28)27(24)15-16-11-13-17(30-2)14-12-16/h3-14,25H,15H2,1-2H3/t24-/m1/s1.
What are the key properties of (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione?
(2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione has a molecular weight of 399.45 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-[(4-methoxyphenyl)methyl]-1'-methylspiro[1H-quinazoline-2,3'-indole]-2',4-dione is sourced from PubChem (CID 95881455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).