C17H16FNO3 — CID 132608894
(3S)-3-(3,5-dimethoxyphenyl)-3-fluoro-1-methylindol-2-one (PubChem CID 132608894) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is (3S)-3-(3,5-dimethoxyphenyl)-3-fluoro-1-methylindol-2-one.
| Compound Name | (3S)-3-(3,5-dimethoxyphenyl)-3-fluoro-1-methylindol-2-one |
|---|---|
| PubChem CID | 132608894 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (3S)-3-(3,5-dimethoxyphenyl)-3-fluoro-1-methylindol-2-one |
| SMILES | COc1cc(OC)cc([C@@]2(F)C(=O)N(C)c3ccccc32)c1 |
| InChI | InChI=1S/C17H16FNO3/c1-19-15-7-5-4-6-14(15)17(18,16(19)20)11-8-12(21-2)10-13(9-11)22-3/h4-10H,1-3H3/t17-/m0/s1 |
| InChIKey | GTWDTUSSFXVGHV-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |