C20H18N2O5 — CID 175172136
(3R)-3-hydroxy-4-[2-(3-methoxyphenyl)-3-oxo-1H-indol-2-yl]-1-methylpyrrolidine-2,5-dione (PubChem CID 175172136) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-[2-(3-methoxyphenyl)-3-oxo-1H-indol-2-yl]-1-methylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-hydroxy-4-[2-(3-methoxyphenyl)-3-oxo-1H-indol-2-yl]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175172136 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3R)-3-hydroxy-4-[2-(3-methoxyphenyl)-3-oxo-1H-indol-2-yl]-1-methylpyrrolidine-2,5-dione |
| SMILES | COc1cccc(C2(C3C(=O)N(C)C(=O)[C@@H]3O)Nc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H18N2O5/c1-22-18(25)15(16(23)19(22)26)20(11-6-5-7-12(10-11)27-2)17(24)13-8-3-4-9-14(13)21-20/h3-10,15-16,21,23H,1-2H3/t15?,16-,20?/m1/s1 |
| InChIKey | HNXNFWQSICJTPG-LFDOHDQPSA-N |
| XLogP | 1.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|