C27H25N3O2 — CID 139606608
7-N,10-bis(4-methoxyphenyl)-9H-acridine-2,7-diamine (PubChem CID 139606608) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 7-N,10-bis(4-methoxyphenyl)-9H-acridine-2,7-diamine.
| Compound Name | 7-N,10-bis(4-methoxyphenyl)-9H-acridine-2,7-diamine |
|---|---|
| PubChem CID | 139606608 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 7-N,10-bis(4-methoxyphenyl)-9H-acridine-2,7-diamine |
| SMILES | COc1ccc(Nc2ccc3c(c2)Cc2cc(N)ccc2N3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O2/c1-31-24-9-4-21(5-10-24)29-22-6-14-27-19(17-22)15-18-16-20(28)3-13-26(18)30(27)23-7-11-25(32-2)12-8-23/h3-14,16-17,29H,15,28H2,1-2H3 |
| InChIKey | WCFWMZWYDDDLNF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|