C29H24O2 — CID 170925493
2',7'-dimethoxy-2,7-dimethyl-9,9'-spirobi[fluorene] (PubChem CID 170925493) has the molecular formula C29H24O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2',7'-dimethoxy-2,7-dimethyl-9,9'-spirobi[fluorene].
| Compound Name | 2',7'-dimethoxy-2,7-dimethyl-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 170925493 |
| Molecular Formula | C29H24O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2',7'-dimethoxy-2,7-dimethyl-9,9'-spirobi[fluorene] |
| SMILES | COc1ccc2c(c1)C1(c3cc(C)ccc3-c3ccc(C)cc31)c1cc(OC)ccc1-2 |
| InChI | InChI=1S/C29H24O2/c1-17-5-9-21-22-10-6-18(2)14-26(22)29(25(21)13-17)27-15-19(30-3)7-11-23(27)24-12-8-20(31-4)16-28(24)29/h5-16H,1-4H3 |
| InChIKey | KECTWQWQYKJJGH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |