C27H24N4 — CID 163763499
2',7'-dimethyl-9,9'-spirobi[fluorene]-2,3,6,7-tetramine (PubChem CID 163763499) has the molecular formula C27H24N4 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2',7'-dimethyl-9,9'-spirobi[fluorene]-2,3,6,7-tetramine.
| Compound Name | 2',7'-dimethyl-9,9'-spirobi[fluorene]-2,3,6,7-tetramine |
|---|---|
| PubChem CID | 163763499 |
| Molecular Formula | C27H24N4 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2',7'-dimethyl-9,9'-spirobi[fluorene]-2,3,6,7-tetramine |
| SMILES | Cc1ccc2c(c1)C1(c3cc(C)ccc3-2)c2cc(N)c(N)cc2-c2cc(N)c(N)cc21 |
| InChI | InChI=1S/C27H24N4/c1-13-3-5-15-16-6-4-14(2)8-20(16)27(19(15)7-13)21-11-25(30)23(28)9-17(21)18-10-24(29)26(31)12-22(18)27/h3-12H,28-31H2,1-2H3 |
| InChIKey | MAFXZGBQMAXCOC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|