C77H56 — CID 140756930
2,2',7,7'-tetrakis[4-(4-methylphenyl)phenyl]-9,9'-spirobi[fluorene] (PubChem CID 140756930) has the molecular formula C77H56 and a molecular weight of 981.29 g/mol. Its IUPAC name is 2,2',7,7'-tetrakis[4-(4-methylphenyl)phenyl]-9,9'-spirobi[fluorene].
| Compound Name | 2,2',7,7'-tetrakis[4-(4-methylphenyl)phenyl]-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 140756930 |
| Molecular Formula | C77H56 |
| Molecular Weight | 981.29 g/mol |
| Exact Mass | 980.44 |
| IUPAC Name | 2,2',7,7'-tetrakis[4-(4-methylphenyl)phenyl]-9,9'-spirobi[fluorene] |
| SMILES | Cc1ccc(-c2ccc(-c3ccc4c(c3)C3(c5cc(-c6ccc(-c7ccc(C)cc7)cc6)ccc5-4)c4cc(-c5ccc(-c6ccc(C)cc6)cc5)ccc4-c4ccc(-c5ccc(-c6ccc(C)cc6)cc5)cc43)cc2)cc1 |
| InChI | InChI=1S/C77H56/c1-49-5-13-53(14-6-49)57-21-29-61(30-22-57)65-37-41-69-70-42-38-66(62-31-23-58(24-32-62)54-15-7-50(2)8-16-54)46-74(70)77(73(69)45-65)75-47-67(63-33-25-59(26-34-63)55-17-9-51(3)10-18-55)39-43-71(75)72-44-40-68(48-76(72)77)64-35-27-60(28-36-64)56-19-11-52(4)12-20-56/h5-48H,1-4H3 |
| InChIKey | WMZBSXOCTBTBCT-UHFFFAOYSA-N |
| XLogP | 20.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.29 |
| LogP ≤ 5 | 20.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |